C23H25FNO2+ — CID 8635366
[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 8635366) has the molecular formula C23H25FNO2+ and a molecular weight of 366.46 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8635366 |
| Molecular Formula | C23H25FNO2+ |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | COc1cccc(C[NH2+]Cc2ccc(C)cc2)c1OCc1ccccc1F |
| InChI | InChI=1S/C23H24FNO2/c1-17-10-12-18(13-11-17)14-25-15-19-7-5-9-22(26-2)23(19)27-16-20-6-3-4-8-21(20)24/h3-13,25H,14-16H2,1-2H3/p+1 |
| InChIKey | RPVHVXXONLIYGZ-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |