C16H19FNO2+ — CID 7452788
(3,4-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]azanium (PubChem CID 7452788) has the molecular formula C16H19FNO2+ and a molecular weight of 276.33 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7452788 |
| Molecular Formula | C16H19FNO2+ |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]Cc2ccccc2F)cc1OC |
| InChI | InChI=1S/C16H18FNO2/c1-19-15-8-7-12(9-16(15)20-2)10-18-11-13-5-3-4-6-14(13)17/h3-9,18H,10-11H2,1-2H3/p+1 |
| InChIKey | SYNXVLNJFVMICD-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |