C17H21FNO+ — CID 2163765
2-(2-fluorophenyl)ethyl-[(4-methoxy-3-methylphenyl)methyl]azanium (PubChem CID 2163765) has the molecular formula C17H21FNO+ and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2-fluorophenyl)ethyl-[(4-methoxy-3-methylphenyl)methyl]azanium.
| Compound Name | 2-(2-fluorophenyl)ethyl-[(4-methoxy-3-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2163765 |
| Molecular Formula | C17H21FNO+ |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(2-fluorophenyl)ethyl-[(4-methoxy-3-methylphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCc2ccccc2F)cc1C |
| InChI | InChI=1S/C17H20FNO/c1-13-11-14(7-8-17(13)20-2)12-19-10-9-15-5-3-4-6-16(15)18/h3-8,11,19H,9-10,12H2,1-2H3/p+1 |
| InChIKey | PIMBAVBOZJSOCR-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|