C23H24Cl2NO2+ — CID 7418975
2-(2,4-dichlorophenyl)ethyl-[(4-methoxy-3-phenylmethoxyphenyl)methyl]azanium (PubChem CID 7418975) has the molecular formula C23H24Cl2NO2+ and a molecular weight of 417.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)ethyl-[(4-methoxy-3-phenylmethoxyphenyl)methyl]azanium.
| Compound Name | 2-(2,4-dichlorophenyl)ethyl-[(4-methoxy-3-phenylmethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7418975 |
| Molecular Formula | C23H24Cl2NO2+ |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-(2,4-dichlorophenyl)ethyl-[(4-methoxy-3-phenylmethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCc2ccc(Cl)cc2Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H23Cl2NO2/c1-27-22-10-7-18(13-23(22)28-16-17-5-3-2-4-6-17)15-26-12-11-19-8-9-20(24)14-21(19)25/h2-10,13-14,26H,11-12,15-16H2,1H3/p+1 |
| InChIKey | WURMGNTUKYIQEK-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|