C23H26ClN2O4S+ — CID 2222652
[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium (PubChem CID 2222652) has the molecular formula C23H26ClN2O4S+ and a molecular weight of 461.99 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium.
| Compound Name | [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2222652 |
| Molecular Formula | C23H26ClN2O4S+ |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
| SMILES | COc1cc(C[NH2+]CCc2ccc(S(N)(=O)=O)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-29-23-14-19(6-11-22(23)30-16-18-2-7-20(24)8-3-18)15-26-13-12-17-4-9-21(10-5-17)31(25,27)28/h2-11,14,26H,12-13,15-16H2,1H3,(H2,25,27,28)/p+1 |
| InChIKey | UTTIUDCHDUGGQB-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|