C18H24ClN2O4S+ — CID 2382053
[(2R)-3-(4-chloro-2-methylphenoxy)-2-hydroxypropyl]-[2-(4-sulfamoylphenyl)ethyl]azanium (PubChem CID 2382053) has the molecular formula C18H24ClN2O4S+ and a molecular weight of 399.92 g/mol. Its IUPAC name is [(2R)-3-(4-chloro-2-methylphenoxy)-2-hydroxypropyl]-[2-(4-sulfamoylphenyl)ethyl]azanium.
| Compound Name | [(2R)-3-(4-chloro-2-methylphenoxy)-2-hydroxypropyl]-[2-(4-sulfamoylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2382053 |
| Molecular Formula | C18H24ClN2O4S+ |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(2R)-3-(4-chloro-2-methylphenoxy)-2-hydroxypropyl]-[2-(4-sulfamoylphenyl)ethyl]azanium |
| SMILES | Cc1cc(Cl)ccc1OC[C@H](O)C[NH2+]CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H23ClN2O4S/c1-13-10-15(19)4-7-18(13)25-12-16(22)11-21-9-8-14-2-5-17(6-3-14)26(20,23)24/h2-7,10,16,21-22H,8-9,11-12H2,1H3,(H2,20,23,24)/p+1/t16-/m1/s1 |
| InChIKey | GLPZEVOUALLUFT-MRXNPFEDSA-O |
| XLogP | 0.84 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|