C22H30Cl2NO2+ — CID 2086214
[(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-[2-(2,4-dichlorophenyl)ethyl]azanium (PubChem CID 2086214) has the molecular formula C22H30Cl2NO2+ and a molecular weight of 411.39 g/mol. Its IUPAC name is [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-[2-(2,4-dichlorophenyl)ethyl]azanium.
| Compound Name | [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-[2-(2,4-dichlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2086214 |
| Molecular Formula | C22H30Cl2NO2+ |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-[2-(2,4-dichlorophenyl)ethyl]azanium |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC[C@@H](O)C[NH2+]CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H29Cl2NO2/c1-15-11-17(22(2,3)4)6-8-21(15)27-14-19(26)13-25-10-9-16-5-7-18(23)12-20(16)24/h5-8,11-12,19,25-26H,9-10,13-14H2,1-4H3/p+1/t19-/m0/s1 |
| InChIKey | DGKDLJCTMUKITD-IBGZPJMESA-O |
| XLogP | 4.15 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|