C18H32NO3+ — CID 7872632
[(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-(3-methoxypropyl)azanium (PubChem CID 7872632) has the molecular formula C18H32NO3+ and a molecular weight of 310.46 g/mol. Its IUPAC name is [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-(3-methoxypropyl)azanium.
| Compound Name | [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7872632 |
| Molecular Formula | C18H32NO3+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | [(2S)-3-(4-tert-butyl-2-methylphenoxy)-2-hydroxypropyl]-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+]C[C@H](O)COc1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C18H31NO3/c1-14-11-15(18(2,3)4)7-8-17(14)22-13-16(20)12-19-9-6-10-21-5/h7-8,11,16,19-20H,6,9-10,12-13H2,1-5H3/p+1/t16-/m0/s1 |
| InChIKey | QHCJVMKDBOYEFN-INIZCTEOSA-O |
| XLogP | 1.63 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|