C17H32N2O+2 — CID 2299424
2-azaniumylethyl-[4-(4-tert-butyl-2-methylphenoxy)butyl]azanium (PubChem CID 2299424) has the molecular formula C17H32N2O+2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-azaniumylethyl-[4-(4-tert-butyl-2-methylphenoxy)butyl]azanium.
| Compound Name | 2-azaniumylethyl-[4-(4-tert-butyl-2-methylphenoxy)butyl]azanium |
|---|---|
| PubChem CID | 2299424 |
| Molecular Formula | C17H32N2O+2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 2-azaniumylethyl-[4-(4-tert-butyl-2-methylphenoxy)butyl]azanium |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCCCC[NH2+]CC[NH3+] |
| InChI | InChI=1S/C17H30N2O/c1-14-13-15(17(2,3)4)7-8-16(14)20-12-6-5-10-19-11-9-18/h7-8,13,19H,5-6,9-12,18H2,1-4H3/p+2 |
| InChIKey | OHABFNBGVCDIAS-UHFFFAOYSA-P |
| XLogP | 1.26 |
| TPSA | 53.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|