C19H34NO3+ — CID 2297274
2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium (PubChem CID 2297274) has the molecular formula C19H34NO3+ and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium.
| Compound Name | 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 2297274 |
| Molecular Formula | C19H34NO3+ |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+]CCOCCOc1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C19H33NO3/c1-16-15-17(19(2,3)4)7-8-18(16)23-14-13-22-12-10-20-9-6-11-21-5/h7-8,15,20H,6,9-14H2,1-5H3/p+1 |
| InChIKey | HSYKGAKTBAVVGL-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|