C15H26NO3+ — CID 7470336
3-methoxypropyl-[2-[2-(3-methylphenoxy)ethoxy]ethyl]azanium (PubChem CID 7470336) has the molecular formula C15H26NO3+ and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-methoxypropyl-[2-[2-(3-methylphenoxy)ethoxy]ethyl]azanium.
| Compound Name | 3-methoxypropyl-[2-[2-(3-methylphenoxy)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 7470336 |
| Molecular Formula | C15H26NO3+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-methoxypropyl-[2-[2-(3-methylphenoxy)ethoxy]ethyl]azanium |
| SMILES | COCCC[NH2+]CCOCCOc1cccc(C)c1 |
| InChI | InChI=1S/C15H25NO3/c1-14-5-3-6-15(13-14)19-12-11-18-10-8-16-7-4-9-17-2/h3,5-6,13,16H,4,7-12H2,1-2H3/p+1 |
| InChIKey | JGUCDFFQUGBBDT-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|