C15H25ClNO3+ — CID 2280477
2-[2-(2-chloro-6-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium (PubChem CID 2280477) has the molecular formula C15H25ClNO3+ and a molecular weight of 302.82 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium.
| Compound Name | 2-[2-(2-chloro-6-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 2280477 |
| Molecular Formula | C15H25ClNO3+ |
| Molecular Weight | 302.82 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[2-(2-chloro-6-methylphenoxy)ethoxy]ethyl-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+]CCOCCOc1c(C)cccc1Cl |
| InChI | InChI=1S/C15H24ClNO3/c1-13-5-3-6-14(16)15(13)20-12-11-19-10-8-17-7-4-9-18-2/h3,5-6,17H,4,7-12H2,1-2H3/p+1 |
| InChIKey | GTBNCACZNSWQDG-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.82 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|