C16H30N2O+2 — CID 2299817
2-azaniumylethyl-[3-(2-tert-butyl-5-methylphenoxy)propyl]azanium (PubChem CID 2299817) has the molecular formula C16H30N2O+2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-azaniumylethyl-[3-(2-tert-butyl-5-methylphenoxy)propyl]azanium.
| Compound Name | 2-azaniumylethyl-[3-(2-tert-butyl-5-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2299817 |
| Molecular Formula | C16H30N2O+2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.23 |
| IUPAC Name | 2-azaniumylethyl-[3-(2-tert-butyl-5-methylphenoxy)propyl]azanium |
| SMILES | Cc1ccc(C(C)(C)C)c(OCCC[NH2+]CC[NH3+])c1 |
| InChI | InChI=1S/C16H28N2O/c1-13-6-7-14(16(2,3)4)15(12-13)19-11-5-9-18-10-8-17/h6-7,12,18H,5,8-11,17H2,1-4H3/p+2 |
| InChIKey | HNFXGDVXSGJABD-UHFFFAOYSA-P |
| XLogP | 0.87 |
| TPSA | 53.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|