C17H28O2 — CID 106802628
6-(2-tert-butyl-5-methylphenoxy)hexan-3-ol (PubChem CID 106802628) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 6-(2-tert-butyl-5-methylphenoxy)hexan-3-ol.
| Compound Name | 6-(2-tert-butyl-5-methylphenoxy)hexan-3-ol |
|---|---|
| PubChem CID | 106802628 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-(2-tert-butyl-5-methylphenoxy)hexan-3-ol |
| SMILES | CCC(O)CCCOc1cc(C)ccc1C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-6-14(18)8-7-11-19-16-12-13(2)9-10-15(16)17(3,4)5/h9-10,12,14,18H,6-8,11H2,1-5H3 |
| InChIKey | GLGOBOMQZVUOCU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|