C15H25NO2 — CID 64813765
1-amino-3-(2-tert-butyl-5-methylphenoxy)-2-methylpropan-2-ol (PubChem CID 64813765) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-amino-3-(2-tert-butyl-5-methylphenoxy)-2-methylpropan-2-ol.
| Compound Name | 1-amino-3-(2-tert-butyl-5-methylphenoxy)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 64813765 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-amino-3-(2-tert-butyl-5-methylphenoxy)-2-methylpropan-2-ol |
| SMILES | Cc1ccc(C(C)(C)C)c(OCC(C)(O)CN)c1 |
| InChI | InChI=1S/C15H25NO2/c1-11-6-7-12(14(2,3)4)13(8-11)18-10-15(5,17)9-16/h6-8,17H,9-10,16H2,1-5H3 |
| InChIKey | VRTBPDRKPNMVCA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |