C23H34NO4+ — CID 2532633
[(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-[2-(4-methoxyphenyl)ethyl]azanium (PubChem CID 2532633) has the molecular formula C23H34NO4+ and a molecular weight of 388.53 g/mol. Its IUPAC name is [(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-[2-(4-methoxyphenyl)ethyl]azanium.
| Compound Name | [(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-[2-(4-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2532633 |
| Molecular Formula | C23H34NO4+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-[2-(4-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc(CC[NH2+]C[C@@H](O)COc2ccc(OC)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H33NO4/c1-23(2,3)21-14-20(27-5)10-11-22(21)28-16-18(25)15-24-13-12-17-6-8-19(26-4)9-7-17/h6-11,14,18,24-25H,12-13,15-16H2,1-5H3/p+1/t18-/m1/s1 |
| InChIKey | AOUQBZQEYAPCCP-GOSISDBHSA-O |
| XLogP | 2.55 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|