C20H35NO4 — CID 42909782
1-(2-tert-butyl-4-methoxyphenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol (PubChem CID 42909782) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methoxyphenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol.
| Compound Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol |
|---|---|
| PubChem CID | 42909782 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CNCCCOC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H35NO4/c1-15(2)24-11-7-10-21-13-16(22)14-25-19-9-8-17(23-6)12-18(19)20(3,4)5/h8-9,12,15-16,21-22H,7,10-11,13-14H2,1-6H3 |
| InChIKey | JVVOCQARBKPLPV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|