C17H30NO3+ — CID 100798601
[(2S)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-trimethylazanium (PubChem CID 100798601) has the molecular formula C17H30NO3+ and a molecular weight of 296.43 g/mol. Its IUPAC name is [(2S)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [(2S)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 100798601 |
| Molecular Formula | C17H30NO3+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(2S)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]-trimethylazanium |
| SMILES | COc1ccc(OC[C@@H](O)C[N+](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H30NO3/c1-17(2,3)15-10-14(20-7)8-9-16(15)21-12-13(19)11-18(4,5)6/h8-10,13,19H,11-12H2,1-7H3/q+1/t13-/m0/s1 |
| InChIKey | SYQWQHSNOSIMCW-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|