C18H31NO5 — CID 7998050
(2S)-1-[bis(2-hydroxyethyl)amino]-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol (PubChem CID 7998050) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2S)-1-[bis(2-hydroxyethyl)amino]-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[bis(2-hydroxyethyl)amino]-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 7998050 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2S)-1-[bis(2-hydroxyethyl)amino]-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OC[C@@H](O)CN(CCO)CCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31NO5/c1-18(2,3)16-11-15(23-4)5-6-17(16)24-13-14(22)12-19(7-9-20)8-10-21/h5-6,11,14,20-22H,7-10,12-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | BYINXSWQNYJQKF-AWEZNQCLSA-N |
| XLogP | 1.02 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |