C10H14ClNO2 — CID 9159069
(2S)-1-amino-3-(4-chloro-2-methylphenoxy)propan-2-ol (PubChem CID 9159069) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is (2S)-1-amino-3-(4-chloro-2-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-amino-3-(4-chloro-2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 9159069 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (2S)-1-amino-3-(4-chloro-2-methylphenoxy)propan-2-ol |
| SMILES | Cc1cc(Cl)ccc1OC[C@@H](O)CN |
| InChI | InChI=1S/C10H14ClNO2/c1-7-4-8(11)2-3-10(7)14-6-9(13)5-12/h2-4,9,13H,5-6,12H2,1H3/t9-/m0/s1 |
| InChIKey | DGLFKLZBJWAYQV-VIFPVBQESA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |