C11H16ClNO2 — CID 59761773
1-amino-3-(2-chloro-4,5-dimethylphenoxy)propan-2-ol (PubChem CID 59761773) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 1-amino-3-(2-chloro-4,5-dimethylphenoxy)propan-2-ol.
| Compound Name | 1-amino-3-(2-chloro-4,5-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 59761773 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-amino-3-(2-chloro-4,5-dimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(Cl)c(OCC(O)CN)cc1C |
| InChI | InChI=1S/C11H16ClNO2/c1-7-3-10(12)11(4-8(7)2)15-6-9(14)5-13/h3-4,9,14H,5-6,13H2,1-2H3 |
| InChIKey | SWSRIKHYAHXPPZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |