C9H10ClF2NO2 — CID 66793809
1-amino-3-(2-chloro-4,5-difluorophenoxy)propan-2-ol (PubChem CID 66793809) has the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. Its IUPAC name is 1-amino-3-(2-chloro-4,5-difluorophenoxy)propan-2-ol.
| Compound Name | 1-amino-3-(2-chloro-4,5-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 66793809 |
| Molecular Formula | C9H10ClF2NO2 |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 1-amino-3-(2-chloro-4,5-difluorophenoxy)propan-2-ol |
| SMILES | NCC(O)COc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C9H10ClF2NO2/c10-6-1-7(11)8(12)2-9(6)15-4-5(14)3-13/h1-2,5,14H,3-4,13H2 |
| InChIKey | FVZZLQNMIKQTOU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|