C9H10BrF2NO2 — CID 66793719
1-amino-3-(2-bromo-4,6-difluorophenoxy)propan-2-ol (PubChem CID 66793719) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is 1-amino-3-(2-bromo-4,6-difluorophenoxy)propan-2-ol.
| Compound Name | 1-amino-3-(2-bromo-4,6-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 66793719 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 1-amino-3-(2-bromo-4,6-difluorophenoxy)propan-2-ol |
| SMILES | NCC(O)COc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H10BrF2NO2/c10-7-1-5(11)2-8(12)9(7)15-4-6(14)3-13/h1-2,6,14H,3-4,13H2 |
| InChIKey | XTSVUYWWXSZBLH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |