C13H19BrFNO — CID 114200008
3-bromo-2-(2,4-dimethylpentoxy)-5-fluoroaniline (PubChem CID 114200008) has the molecular formula C13H19BrFNO and a molecular weight of 304.20 g/mol. Its IUPAC name is 3-bromo-2-(2,4-dimethylpentoxy)-5-fluoroaniline.
| Compound Name | 3-bromo-2-(2,4-dimethylpentoxy)-5-fluoroaniline |
|---|---|
| PubChem CID | 114200008 |
| Molecular Formula | C13H19BrFNO |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-bromo-2-(2,4-dimethylpentoxy)-5-fluoroaniline |
| SMILES | CC(C)CC(C)COc1c(N)cc(F)cc1Br |
| InChI | InChI=1S/C13H19BrFNO/c1-8(2)4-9(3)7-17-13-11(14)5-10(15)6-12(13)16/h5-6,8-9H,4,7,16H2,1-3H3 |
| InChIKey | IZNFUPUYULUTCG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|