C9H11F2NO2 — CID 63269333
1-amino-3-(2,5-difluorophenoxy)propan-2-ol (PubChem CID 63269333) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 1-amino-3-(2,5-difluorophenoxy)propan-2-ol.
| Compound Name | 1-amino-3-(2,5-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 63269333 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-amino-3-(2,5-difluorophenoxy)propan-2-ol |
| SMILES | NCC(O)COc1cc(F)ccc1F |
| InChI | InChI=1S/C9H11F2NO2/c10-6-1-2-8(11)9(3-6)14-5-7(13)4-12/h1-3,7,13H,4-5,12H2 |
| InChIKey | WBOXCMUIRYAOCZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |