C15H15F2NO3 — CID 63268739
1-(3-aminophenoxy)-3-(2,5-difluorophenoxy)propan-2-ol (PubChem CID 63268739) has the molecular formula C15H15F2NO3 and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-(3-aminophenoxy)-3-(2,5-difluorophenoxy)propan-2-ol.
| Compound Name | 1-(3-aminophenoxy)-3-(2,5-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 63268739 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(3-aminophenoxy)-3-(2,5-difluorophenoxy)propan-2-ol |
| SMILES | Nc1cccc(OCC(O)COc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C15H15F2NO3/c16-10-4-5-14(17)15(6-10)21-9-12(19)8-20-13-3-1-2-11(18)7-13/h1-7,12,19H,8-9,18H2 |
| InChIKey | YOWPBRNSLPDBOY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|