C12H19NO4 — CID 62269537
1-(3-aminophenoxy)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 62269537) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(3-aminophenoxy)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(3-aminophenoxy)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 62269537 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-(3-aminophenoxy)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)COc1cccc(N)c1 |
| InChI | InChI=1S/C12H19NO4/c1-15-5-6-16-8-11(14)9-17-12-4-2-3-10(13)7-12/h2-4,7,11,14H,5-6,8-9,13H2,1H3 |
| InChIKey | QCYRVWNYZARAIX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|