C15H21F2NO3 — CID 109415726
1-(2,5-difluorophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol (PubChem CID 109415726) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 1-(2,5-difluorophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol.
| Compound Name | 1-(2,5-difluorophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 109415726 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-(2,5-difluorophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
| SMILES | CC1CN(CC(O)COc2cc(F)ccc2F)CC(C)O1 |
| InChI | InChI=1S/C15H21F2NO3/c1-10-6-18(7-11(2)21-10)8-13(19)9-20-15-5-12(16)3-4-14(15)17/h3-5,10-11,13,19H,6-9H2,1-2H3 |
| InChIKey | QWMPJJPIAXKTGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |