C15H24N2O3 — CID 43173893
1-(2-aminophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol (PubChem CID 43173893) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-aminophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol.
| Compound Name | 1-(2-aminophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 43173893 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(2-aminophenoxy)-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
| SMILES | CC1CN(CC(O)COc2ccccc2N)CC(C)O1 |
| InChI | InChI=1S/C15H24N2O3/c1-11-7-17(8-12(2)20-11)9-13(18)10-19-15-6-4-3-5-14(15)16/h3-6,11-13,18H,7-10,16H2,1-2H3 |
| InChIKey | KNSXTDOGEISLBA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|