C16H25ClN2O3 — CID 1353039
(2R)-1-(4-chloro-2-methylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol (PubChem CID 1353039) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is (2R)-1-(4-chloro-2-methylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(4-chloro-2-methylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 1353039 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-1-(4-chloro-2-methylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cc(Cl)ccc1OC[C@H](O)CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H25ClN2O3/c1-13-10-14(17)2-3-16(13)22-12-15(21)11-19-6-4-18(5-7-19)8-9-20/h2-3,10,15,20-21H,4-9,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | MWUUVFQEKHMUFL-OAHLLOKOSA-N |
| XLogP | 1.00 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |