C14H23Cl2NO2 — CID 44787018
1-(tert-butylamino)-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride (PubChem CID 44787018) has the molecular formula C14H23Cl2NO2 and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-(tert-butylamino)-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44787018 |
| Molecular Formula | C14H23Cl2NO2 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(tert-butylamino)-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1OCC(O)CNC(C)(C)C.Cl |
| InChI | InChI=1S/C14H22ClNO2.ClH/c1-10-7-11(15)5-6-13(10)18-9-12(17)8-16-14(2,3)4;/h5-7,12,16-17H,8-9H2,1-4H3;1H |
| InChIKey | CIMNKGZTQQPJKV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |