C18H29N3O3 — CID 14853124
1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-methylphenyl]-3-prop-2-enylurea (PubChem CID 14853124) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-methylphenyl]-3-prop-2-enylurea.
| Compound Name | 1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-methylphenyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 14853124 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-methylphenyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(OCC(O)CNC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-6-9-19-17(23)21-14-7-8-16(13(2)10-14)24-12-15(22)11-20-18(3,4)5/h6-8,10,15,20,22H,1,9,11-12H2,2-5H3,(H2,19,21,23) |
| InChIKey | QSPRBYWGLZPEGG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|