C20H27Cl2NO2 — CID 138958863
1-(4-chloro-2-methylphenoxy)-3-[1-(4-ethylphenyl)ethylamino]propan-2-ol;hydrochloride (PubChem CID 138958863) has the molecular formula C20H27Cl2NO2 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenoxy)-3-[1-(4-ethylphenyl)ethylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-(4-chloro-2-methylphenoxy)-3-[1-(4-ethylphenyl)ethylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138958863 |
| Molecular Formula | C20H27Cl2NO2 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-(4-chloro-2-methylphenoxy)-3-[1-(4-ethylphenyl)ethylamino]propan-2-ol;hydrochloride |
| SMILES | CCc1ccc(C(C)NCC(O)COc2ccc(Cl)cc2C)cc1.Cl |
| InChI | InChI=1S/C20H26ClNO2.ClH/c1-4-16-5-7-17(8-6-16)15(3)22-12-19(23)13-24-20-10-9-18(21)11-14(20)2;/h5-11,15,19,22-23H,4,12-13H2,1-3H3;1H |
| InChIKey | UHBUSVOIBXJSDI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |