C10H13ClNaO5S+ — CID 157108260
sodium 1-(4-chloro-2-methylphenoxy)propan-2-yl hydrogen sulfate (PubChem CID 157108260) has the molecular formula C10H13ClNaO5S+ and a molecular weight of 303.72 g/mol. Its IUPAC name is sodium 1-(4-chloro-2-methylphenoxy)propan-2-yl hydrogen sulfate.
| Compound Name | sodium 1-(4-chloro-2-methylphenoxy)propan-2-yl hydrogen sulfate |
|---|---|
| PubChem CID | 157108260 |
| Molecular Formula | C10H13ClNaO5S+ |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | sodium 1-(4-chloro-2-methylphenoxy)propan-2-yl hydrogen sulfate |
| SMILES | Cc1cc(Cl)ccc1OCC(C)OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C10H13ClO5S.Na/c1-7-5-9(11)3-4-10(7)15-6-8(2)16-17(12,13)14;/h3-5,8H,6H2,1-2H3,(H,12,13,14);/q;+1 |
| InChIKey | PLEZQYIKDMRFSN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|