C21H23ClNO2+ — CID 2502105
2-(4-chlorophenyl)ethyl-[(2S)-2-hydroxy-3-naphthalen-2-yloxypropyl]azanium (PubChem CID 2502105) has the molecular formula C21H23ClNO2+ and a molecular weight of 356.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl-[(2S)-2-hydroxy-3-naphthalen-2-yloxypropyl]azanium.
| Compound Name | 2-(4-chlorophenyl)ethyl-[(2S)-2-hydroxy-3-naphthalen-2-yloxypropyl]azanium |
|---|---|
| PubChem CID | 2502105 |
| Molecular Formula | C21H23ClNO2+ |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(4-chlorophenyl)ethyl-[(2S)-2-hydroxy-3-naphthalen-2-yloxypropyl]azanium |
| SMILES | O[C@@H](C[NH2+]CCc1ccc(Cl)cc1)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H22ClNO2/c22-19-8-5-16(6-9-19)11-12-23-14-20(24)15-25-21-10-7-17-3-1-2-4-18(17)13-21/h1-10,13,20,23-24H,11-12,14-15H2/p+1/t20-/m0/s1 |
| InChIKey | HTUFETLGSIIEPM-FQEVSTJZSA-O |
| XLogP | 3.04 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|