C16H21ClNO3+ — CID 2110408
2-(4-chlorophenyl)ethyl-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]azanium (PubChem CID 2110408) has the molecular formula C16H21ClNO3+ and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]azanium.
| Compound Name | 2-(4-chlorophenyl)ethyl-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2110408 |
| Molecular Formula | C16H21ClNO3+ |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(4-chlorophenyl)ethyl-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]azanium |
| SMILES | O[C@H](C[NH2+]CCc1ccc(Cl)cc1)COCc1ccco1 |
| InChI | InChI=1S/C16H20ClNO3/c17-14-5-3-13(4-6-14)7-8-18-10-15(19)11-20-12-16-2-1-9-21-16/h1-6,9,15,18-19H,7-8,10-12H2/p+1/t15-/m1/s1 |
| InChIKey | HJDMWHWAKURTBT-OAHLLOKOSA-O |
| XLogP | 1.62 |
| TPSA | 59.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|