C14H14Cl2O4 — CID 109412981
1-(2,4-dichlorophenoxy)-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 109412981) has the molecular formula C14H14Cl2O4 and a molecular weight of 317.17 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 109412981 |
| Molecular Formula | C14H14Cl2O4 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1ccco1)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2O4/c15-10-3-4-14(13(16)6-10)20-8-11(17)7-18-9-12-2-1-5-19-12/h1-6,11,17H,7-9H2 |
| InChIKey | NEFWJYYGZNLOOJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |