C14H15Cl2NO3 — CID 60901726
1-(2,3-dichloroanilino)-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 60901726) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 1-(2,3-dichloroanilino)-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(2,3-dichloroanilino)-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60901726 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-(2,3-dichloroanilino)-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(CNc1cccc(Cl)c1Cl)COCc1ccco1 |
| InChI | InChI=1S/C14H15Cl2NO3/c15-12-4-1-5-13(14(12)16)17-7-10(18)8-19-9-11-3-2-6-20-11/h1-6,10,17-18H,7-9H2 |
| InChIKey | LLSOBGRLGORKCC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |