C14H14BrF2NO3 — CID 102853485
1-(5-bromo-2,4-difluoroanilino)-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 102853485) has the molecular formula C14H14BrF2NO3 and a molecular weight of 362.17 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluoroanilino)-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(5-bromo-2,4-difluoroanilino)-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 102853485 |
| Molecular Formula | C14H14BrF2NO3 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(5-bromo-2,4-difluoroanilino)-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(CNc1cc(Br)c(F)cc1F)COCc1ccco1 |
| InChI | InChI=1S/C14H14BrF2NO3/c15-11-4-14(13(17)5-12(11)16)18-6-9(19)7-20-8-10-2-1-3-21-10/h1-5,9,18-19H,6-8H2 |
| InChIKey | BEKWABWDIFJPDY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|