C13H16BrF2NO2 — CID 102853501
1-(5-bromo-2,4-difluoroanilino)-3-(cyclopropylmethoxy)propan-2-ol (PubChem CID 102853501) has the molecular formula C13H16BrF2NO2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluoroanilino)-3-(cyclopropylmethoxy)propan-2-ol.
| Compound Name | 1-(5-bromo-2,4-difluoroanilino)-3-(cyclopropylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 102853501 |
| Molecular Formula | C13H16BrF2NO2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 1-(5-bromo-2,4-difluoroanilino)-3-(cyclopropylmethoxy)propan-2-ol |
| SMILES | OC(CNc1cc(Br)c(F)cc1F)COCC1CC1 |
| InChI | InChI=1S/C13H16BrF2NO2/c14-10-3-13(12(16)4-11(10)15)17-5-9(18)7-19-6-8-1-2-8/h3-4,8-9,17-18H,1-2,5-7H2 |
| InChIKey | NRLAYJGTMPLISI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|