C14H18BrF2NO — CID 107611038
1-(4-bromo-2,5-difluoroanilino)-3-cyclopentylpropan-2-ol (PubChem CID 107611038) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluoroanilino)-3-cyclopentylpropan-2-ol.
| Compound Name | 1-(4-bromo-2,5-difluoroanilino)-3-cyclopentylpropan-2-ol |
|---|---|
| PubChem CID | 107611038 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-(4-bromo-2,5-difluoroanilino)-3-cyclopentylpropan-2-ol |
| SMILES | OC(CNc1cc(F)c(Br)cc1F)CC1CCCC1 |
| InChI | InChI=1S/C14H18BrF2NO/c15-11-6-13(17)14(7-12(11)16)18-8-10(19)5-9-3-1-2-4-9/h6-7,9-10,18-19H,1-5,8H2 |
| InChIKey | DYBSCLBXCFFTSF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|