C15H18Br2F2 — CID 114458768
[2-bromo-2-(4-bromo-2,5-difluorophenyl)ethyl]cycloheptane (PubChem CID 114458768) has the molecular formula C15H18Br2F2 and a molecular weight of 396.11 g/mol. Its IUPAC name is [2-bromo-2-(4-bromo-2,5-difluorophenyl)ethyl]cycloheptane.
| Compound Name | [2-bromo-2-(4-bromo-2,5-difluorophenyl)ethyl]cycloheptane |
|---|---|
| PubChem CID | 114458768 |
| Molecular Formula | C15H18Br2F2 |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | [2-bromo-2-(4-bromo-2,5-difluorophenyl)ethyl]cycloheptane |
| SMILES | Fc1cc(C(Br)CC2CCCCCC2)c(F)cc1Br |
| InChI | InChI=1S/C15H18Br2F2/c16-12(7-10-5-3-1-2-4-6-10)11-8-15(19)13(17)9-14(11)18/h8-10,12H,1-7H2 |
| InChIKey | BGGXXRQZOSGYDZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|