C17H24BrFO2 — CID 114458761
[2-bromo-2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]cycloheptane (PubChem CID 114458761) has the molecular formula C17H24BrFO2 and a molecular weight of 359.28 g/mol. Its IUPAC name is [2-bromo-2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]cycloheptane.
| Compound Name | [2-bromo-2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]cycloheptane |
|---|---|
| PubChem CID | 114458761 |
| Molecular Formula | C17H24BrFO2 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [2-bromo-2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]cycloheptane |
| SMILES | COc1cc(F)c(C(Br)CC2CCCCCC2)cc1OC |
| InChI | InChI=1S/C17H24BrFO2/c1-20-16-10-13(15(19)11-17(16)21-2)14(18)9-12-7-5-3-4-6-8-12/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | HLCJWJKWAJODKX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|