C14H17BrF2 — CID 63442452
1-(1-bromo-2-cyclohexylethyl)-2,4-difluorobenzene (PubChem CID 63442452) has the molecular formula C14H17BrF2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(1-bromo-2-cyclohexylethyl)-2,4-difluorobenzene.
| Compound Name | 1-(1-bromo-2-cyclohexylethyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 63442452 |
| Molecular Formula | C14H17BrF2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(1-bromo-2-cyclohexylethyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(C(Br)CC2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C14H17BrF2/c15-13(8-10-4-2-1-3-5-10)12-7-6-11(16)9-14(12)17/h6-7,9-10,13H,1-5,8H2 |
| InChIKey | FWMSJOSSRCTATH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|