C14H19F2N — CID 80502991
2-cyclohexyl-2-(2,4-difluorophenyl)ethanamine (PubChem CID 80502991) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,4-difluorophenyl)ethanamine.
| Compound Name | 2-cyclohexyl-2-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 80502991 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-cyclohexyl-2-(2,4-difluorophenyl)ethanamine |
| SMILES | NCC(c1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C14H19F2N/c15-11-6-7-12(14(16)8-11)13(9-17)10-4-2-1-3-5-10/h6-8,10,13H,1-5,9,17H2 |
| InChIKey | GVXPFDFXHJFPBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |