C18H27F2N — CID 83975135
2-(4-tert-butylcyclohexyl)-2-(2,4-difluorophenyl)ethanamine (PubChem CID 83975135) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)-2-(2,4-difluorophenyl)ethanamine.
| Compound Name | 2-(4-tert-butylcyclohexyl)-2-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 83975135 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)-2-(2,4-difluorophenyl)ethanamine |
| SMILES | CC(C)(C)C1CCC(C(CN)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H27F2N/c1-18(2,3)13-6-4-12(5-7-13)16(11-21)15-9-8-14(19)10-17(15)20/h8-10,12-13,16H,4-7,11,21H2,1-3H3 |
| InChIKey | YRGTVNBILYFQMR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |