C15H18BrClF2 — CID 65021044
[(4-bromo-2,5-difluorophenyl)-chloromethyl]cyclooctane (PubChem CID 65021044) has the molecular formula C15H18BrClF2 and a molecular weight of 351.66 g/mol. Its IUPAC name is [(4-bromo-2,5-difluorophenyl)-chloromethyl]cyclooctane.
| Compound Name | [(4-bromo-2,5-difluorophenyl)-chloromethyl]cyclooctane |
|---|---|
| PubChem CID | 65021044 |
| Molecular Formula | C15H18BrClF2 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [(4-bromo-2,5-difluorophenyl)-chloromethyl]cyclooctane |
| SMILES | Fc1cc(C(Cl)C2CCCCCCC2)c(F)cc1Br |
| InChI | InChI=1S/C15H18BrClF2/c16-12-9-13(18)11(8-14(12)19)15(17)10-6-4-2-1-3-5-7-10/h8-10,15H,1-7H2 |
| InChIKey | KGWRNEBQRLDULL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|