C11H10BrClF2O2S — CID 64905816
3-[(4-bromo-2,5-difluorophenyl)-chloromethyl]thiolane 1,1-dioxide (PubChem CID 64905816) has the molecular formula C11H10BrClF2O2S and a molecular weight of 359.62 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-difluorophenyl)-chloromethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(4-bromo-2,5-difluorophenyl)-chloromethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64905816 |
| Molecular Formula | C11H10BrClF2O2S |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 3-[(4-bromo-2,5-difluorophenyl)-chloromethyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(Cl)c2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C11H10BrClF2O2S/c12-8-4-9(14)7(3-10(8)15)11(13)6-1-2-18(16,17)5-6/h3-4,6,11H,1-2,5H2 |
| InChIKey | IYHMNUPXPCBKER-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|