C11H10ClF3O2S — CID 64903948
3-[chloro-(2,4,6-trifluorophenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64903948) has the molecular formula C11H10ClF3O2S and a molecular weight of 298.71 g/mol. Its IUPAC name is 3-[chloro-(2,4,6-trifluorophenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[chloro-(2,4,6-trifluorophenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64903948 |
| Molecular Formula | C11H10ClF3O2S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 3-[chloro-(2,4,6-trifluorophenyl)methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(Cl)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C11H10ClF3O2S/c12-11(6-1-2-18(16,17)5-6)10-8(14)3-7(13)4-9(10)15/h3-4,6,11H,1-2,5H2 |
| InChIKey | DLEPNOKKUXGGGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|