C11H13BrFNO2S — CID 81441963
(4-bromo-3-fluorophenyl)-(1,1-dioxothiolan-3-yl)methanamine (PubChem CID 81441963) has the molecular formula C11H13BrFNO2S and a molecular weight of 322.20 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-(1,1-dioxothiolan-3-yl)methanamine.
| Compound Name | (4-bromo-3-fluorophenyl)-(1,1-dioxothiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 81441963 |
| Molecular Formula | C11H13BrFNO2S |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-(1,1-dioxothiolan-3-yl)methanamine |
| SMILES | NC(c1ccc(Br)c(F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13BrFNO2S/c12-9-2-1-7(5-10(9)13)11(14)8-3-4-17(15,16)6-8/h1-2,5,8,11H,3-4,6,14H2 |
| InChIKey | STKHZWFHZLFYLA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |